C32H36BrNO7 — CID 98123036
cyclopentyl (4R,7S)-4-(2-bromo-4,5-dimethoxyphenyl)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate (PubChem CID 98123036) has the molecular formula C32H36BrNO7 and a molecular weight of 626.54 g/mol. Its IUPAC name is cyclopentyl (4R,7S)-4-(2-bromo-4,5-dimethoxyphenyl)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate.
| Compound Name | cyclopentyl (4R,7S)-4-(2-bromo-4,5-dimethoxyphenyl)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 98123036 |
| Molecular Formula | C32H36BrNO7 |
| Molecular Weight | 626.54 g/mol |
| Exact Mass | 625.17 |
| IUPAC Name | cyclopentyl (4R,7S)-4-(2-bromo-4,5-dimethoxyphenyl)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
| SMILES | COc1ccc([C@@H]2CC(=O)C3=C(C2)NC(C)=C(C(=O)OC2CCCC2)[C@@H]3c2cc(OC)c(OC)cc2Br)cc1OC |
| InChI | InChI=1S/C32H36BrNO7/c1-17-29(32(36)41-20-8-6-7-9-20)30(21-15-27(39-4)28(40-5)16-22(21)33)31-23(34-17)12-19(13-24(31)35)18-10-11-25(37-2)26(14-18)38-3/h10-11,14-16,19-20,30,34H,6-9,12-13H2,1-5H3/t19-,30-/m0/s1 |
| InChIKey | XPFRAIROXUAEET-ADSBAMQRSA-N |
| XLogP | 6.33 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.54 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |