C31H36BrNO8 — CID 98183111
2-ethoxyethyl (4S,7R)-4-(2-bromo-4,5-dimethoxyphenyl)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate (PubChem CID 98183111) has the molecular formula C31H36BrNO8 and a molecular weight of 630.53 g/mol. Its IUPAC name is 2-ethoxyethyl (4S,7R)-4-(2-bromo-4,5-dimethoxyphenyl)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate.
| Compound Name | 2-ethoxyethyl (4S,7R)-4-(2-bromo-4,5-dimethoxyphenyl)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 98183111 |
| Molecular Formula | C31H36BrNO8 |
| Molecular Weight | 630.53 g/mol |
| Exact Mass | 629.16 |
| IUPAC Name | 2-ethoxyethyl (4S,7R)-4-(2-bromo-4,5-dimethoxyphenyl)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
| SMILES | CCOCCOC(=O)C1=C(C)NC2=C(C(=O)C[C@H](c3ccc(OC)c(OC)c3)C2)[C@@H]1c1cc(OC)c(OC)cc1Br |
| InChI | InChI=1S/C31H36BrNO8/c1-7-40-10-11-41-31(35)28-17(2)33-22-12-19(18-8-9-24(36-3)25(14-18)37-4)13-23(34)30(22)29(28)20-15-26(38-5)27(39-6)16-21(20)32/h8-9,14-16,19,29,33H,7,10-13H2,1-6H3/t19-,29-/m1/s1 |
| InChIKey | LXSVSLNPPCLZHL-SONOPUAISA-N |
| XLogP | 5.42 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.53 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|