C32H39NO7 — CID 98178162
2-ethoxyethyl (4S,7S)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4-(2-propan-2-yloxyphenyl)-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate (PubChem CID 98178162) has the molecular formula C32H39NO7 and a molecular weight of 549.66 g/mol. Its IUPAC name is 2-ethoxyethyl (4S,7S)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4-(2-propan-2-yloxyphenyl)-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate.
| Compound Name | 2-ethoxyethyl (4S,7S)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4-(2-propan-2-yloxyphenyl)-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 98178162 |
| Molecular Formula | C32H39NO7 |
| Molecular Weight | 549.66 g/mol |
| Exact Mass | 549.27 |
| IUPAC Name | 2-ethoxyethyl (4S,7S)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4-(2-propan-2-yloxyphenyl)-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
| SMILES | CCOCCOC(=O)C1=C(C)NC2=C(C(=O)C[C@@H](c3ccc(OC)c(OC)c3)C2)[C@@H]1c1ccccc1OC(C)C |
| InChI | InChI=1S/C32H39NO7/c1-7-38-14-15-39-32(35)29-20(4)33-24-16-22(21-12-13-27(36-5)28(18-21)37-6)17-25(34)31(24)30(29)23-10-8-9-11-26(23)40-19(2)3/h8-13,18-19,22,30,33H,7,14-17H2,1-6H3/t22-,30+/m0/s1 |
| InChIKey | BLAYSRDLQMWOLT-SMSORMJASA-N |
| XLogP | 5.43 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.66 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|