C32H39NO6 — CID 994970
2-methylpropyl (4R,7S)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4-(2-propan-2-yloxyphenyl)-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate (PubChem CID 994970) has the molecular formula C32H39NO6 and a molecular weight of 533.67 g/mol. Its IUPAC name is 2-methylpropyl (4R,7S)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4-(2-propan-2-yloxyphenyl)-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate.
| Compound Name | 2-methylpropyl (4R,7S)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4-(2-propan-2-yloxyphenyl)-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 994970 |
| Molecular Formula | C32H39NO6 |
| Molecular Weight | 533.67 g/mol |
| Exact Mass | 533.28 |
| IUPAC Name | 2-methylpropyl (4R,7S)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4-(2-propan-2-yloxyphenyl)-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
| SMILES | COc1ccc([C@@H]2CC(=O)C3=C(C2)NC(C)=C(C(=O)OCC(C)C)[C@@H]3c2ccccc2OC(C)C)cc1OC |
| InChI | InChI=1S/C32H39NO6/c1-18(2)17-38-32(35)29-20(5)33-24-14-22(21-12-13-27(36-6)28(16-21)37-7)15-25(34)31(24)30(29)23-10-8-9-11-26(23)39-19(3)4/h8-13,16,18-19,22,30,33H,14-15,17H2,1-7H3/t22-,30-/m0/s1 |
| InChIKey | XEDLLLVBUUKNNG-CHJDUVSTSA-N |
| XLogP | 6.05 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.67 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |