C29H32FNO5 — CID 994974
2-methylpropyl (4S,7S)-7-(3,4-dimethoxyphenyl)-4-(3-fluorophenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate (PubChem CID 994974) has the molecular formula C29H32FNO5 and a molecular weight of 493.58 g/mol. Its IUPAC name is 2-methylpropyl (4S,7S)-7-(3,4-dimethoxyphenyl)-4-(3-fluorophenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate.
| Compound Name | 2-methylpropyl (4S,7S)-7-(3,4-dimethoxyphenyl)-4-(3-fluorophenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 994974 |
| Molecular Formula | C29H32FNO5 |
| Molecular Weight | 493.58 g/mol |
| Exact Mass | 493.23 |
| IUPAC Name | 2-methylpropyl (4S,7S)-7-(3,4-dimethoxyphenyl)-4-(3-fluorophenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
| SMILES | COc1ccc([C@@H]2CC(=O)C3=C(C2)NC(C)=C(C(=O)OCC(C)C)[C@H]3c2cccc(F)c2)cc1OC |
| InChI | InChI=1S/C29H32FNO5/c1-16(2)15-36-29(33)26-17(3)31-22-12-20(18-9-10-24(34-4)25(14-18)35-5)13-23(32)28(22)27(26)19-7-6-8-21(30)11-19/h6-11,14,16,20,27,31H,12-13,15H2,1-5H3/t20-,27+/m0/s1 |
| InChIKey | ZPYJLMNAURGBIH-CCLHPLFOSA-N |
| XLogP | 5.40 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.58 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |