C31H36BrNO7 — CID 98122758
2-methylpropyl (4R,7R)-4-(3-bromo-4,5-dimethoxyphenyl)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate (PubChem CID 98122758) has the molecular formula C31H36BrNO7 and a molecular weight of 614.53 g/mol. Its IUPAC name is 2-methylpropyl (4R,7R)-4-(3-bromo-4,5-dimethoxyphenyl)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate.
| Compound Name | 2-methylpropyl (4R,7R)-4-(3-bromo-4,5-dimethoxyphenyl)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 98122758 |
| Molecular Formula | C31H36BrNO7 |
| Molecular Weight | 614.53 g/mol |
| Exact Mass | 613.17 |
| IUPAC Name | 2-methylpropyl (4R,7R)-4-(3-bromo-4,5-dimethoxyphenyl)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
| SMILES | COc1ccc([C@H]2CC(=O)C3=C(C2)NC(C)=C(C(=O)OCC(C)C)[C@@H]3c2cc(Br)c(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C31H36BrNO7/c1-16(2)15-40-31(35)27-17(3)33-22-11-19(18-8-9-24(36-4)25(13-18)37-5)12-23(34)29(22)28(27)20-10-21(32)30(39-7)26(14-20)38-6/h8-10,13-14,16,19,28,33H,11-12,15H2,1-7H3/t19-,28+/m1/s1 |
| InChIKey | RHEKAAMPMMDYOL-GDJIYFAZSA-N |
| XLogP | 6.04 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.53 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |