C36H39NO6 — CID 98182365
2-methylpropyl (4R,7R)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4-(2-phenylmethoxyphenyl)-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate (PubChem CID 98182365) has the molecular formula C36H39NO6 and a molecular weight of 581.71 g/mol. Its IUPAC name is 2-methylpropyl (4R,7R)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4-(2-phenylmethoxyphenyl)-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate.
| Compound Name | 2-methylpropyl (4R,7R)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4-(2-phenylmethoxyphenyl)-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 98182365 |
| Molecular Formula | C36H39NO6 |
| Molecular Weight | 581.71 g/mol |
| Exact Mass | 581.28 |
| IUPAC Name | 2-methylpropyl (4R,7R)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4-(2-phenylmethoxyphenyl)-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
| SMILES | COc1ccc([C@H]2CC(=O)C3=C(C2)NC(C)=C(C(=O)OCC(C)C)[C@@H]3c2ccccc2OCc2ccccc2)cc1OC |
| InChI | InChI=1S/C36H39NO6/c1-22(2)20-43-36(39)33-23(3)37-28-17-26(25-15-16-31(40-4)32(19-25)41-5)18-29(38)35(28)34(33)27-13-9-10-14-30(27)42-21-24-11-7-6-8-12-24/h6-16,19,22,26,34,37H,17-18,20-21H2,1-5H3/t26-,34+/m1/s1 |
| InChIKey | VPKPSLHVOJYBGT-SFRLIIPVSA-N |
| XLogP | 6.84 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.71 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |