C29H33NO6 — CID 51375618
[(2S)-butan-2-yl] (4S,7R)-7-(3,4-dimethoxyphenyl)-4-(3-hydroxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate (PubChem CID 51375618) has the molecular formula C29H33NO6 and a molecular weight of 491.58 g/mol. Its IUPAC name is [(2S)-butan-2-yl] (4S,7R)-7-(3,4-dimethoxyphenyl)-4-(3-hydroxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate.
| Compound Name | [(2S)-butan-2-yl] (4S,7R)-7-(3,4-dimethoxyphenyl)-4-(3-hydroxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 51375618 |
| Molecular Formula | C29H33NO6 |
| Molecular Weight | 491.58 g/mol |
| Exact Mass | 491.23 |
| IUPAC Name | [(2S)-butan-2-yl] (4S,7R)-7-(3,4-dimethoxyphenyl)-4-(3-hydroxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
| SMILES | CC[C@H](C)OC(=O)C1=C(C)NC2=C(C(=O)C[C@H](c3ccc(OC)c(OC)c3)C2)[C@@H]1c1cccc(O)c1 |
| InChI | InChI=1S/C29H33NO6/c1-6-16(2)36-29(33)26-17(3)30-22-13-20(18-10-11-24(34-4)25(15-18)35-5)14-23(32)28(22)27(26)19-8-7-9-21(31)12-19/h7-12,15-16,20,27,30-31H,6,13-14H2,1-5H3/t16-,20+,27+/m0/s1 |
| InChIKey | MTHOMJKKJPYPHK-PGXOYOEPSA-N |
| XLogP | 5.11 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.58 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |