C36H39NO6 — CID 98182388
butyl (4S,7R)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4-(3-phenylmethoxyphenyl)-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate (PubChem CID 98182388) has the molecular formula C36H39NO6 and a molecular weight of 581.71 g/mol. Its IUPAC name is butyl (4S,7R)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4-(3-phenylmethoxyphenyl)-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate.
| Compound Name | butyl (4S,7R)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4-(3-phenylmethoxyphenyl)-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 98182388 |
| Molecular Formula | C36H39NO6 |
| Molecular Weight | 581.71 g/mol |
| Exact Mass | 581.28 |
| IUPAC Name | butyl (4S,7R)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4-(3-phenylmethoxyphenyl)-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
| SMILES | CCCCOC(=O)C1=C(C)NC2=C(C(=O)C[C@H](c3ccc(OC)c(OC)c3)C2)[C@@H]1c1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C36H39NO6/c1-5-6-17-42-36(39)33-23(2)37-29-19-27(25-15-16-31(40-3)32(21-25)41-4)20-30(38)35(29)34(33)26-13-10-14-28(18-26)43-22-24-11-8-7-9-12-24/h7-16,18,21,27,34,37H,5-6,17,19-20,22H2,1-4H3/t27-,34-/m1/s1 |
| InChIKey | DDCIXWPFRNXVHM-QRRWFCJLSA-N |
| XLogP | 6.99 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.71 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|