C33H31ClN2O7 — CID 98122942
2-phenylethyl (4S,7R)-4-(4-chloro-3-nitrophenyl)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate (PubChem CID 98122942) has the molecular formula C33H31ClN2O7 and a molecular weight of 603.07 g/mol. Its IUPAC name is 2-phenylethyl (4S,7R)-4-(4-chloro-3-nitrophenyl)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate.
| Compound Name | 2-phenylethyl (4S,7R)-4-(4-chloro-3-nitrophenyl)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 98122942 |
| Molecular Formula | C33H31ClN2O7 |
| Molecular Weight | 603.07 g/mol |
| Exact Mass | 602.18 |
| IUPAC Name | 2-phenylethyl (4S,7R)-4-(4-chloro-3-nitrophenyl)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
| SMILES | COc1ccc([C@H]2CC(=O)C3=C(C2)NC(C)=C(C(=O)OCCc2ccccc2)[C@H]3c2ccc(Cl)c([N+](=O)[O-])c2)cc1OC |
| InChI | InChI=1S/C33H31ClN2O7/c1-19-30(33(38)43-14-13-20-7-5-4-6-8-20)31(22-9-11-24(34)26(16-22)36(39)40)32-25(35-19)15-23(17-27(32)37)21-10-12-28(41-2)29(18-21)42-3/h4-12,16,18,23,31,35H,13-15,17H2,1-3H3/t23-,31-/m1/s1 |
| InChIKey | PTKGFBZMBKLNKL-SLGOVJDISA-N |
| XLogP | 6.41 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.07 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|