C29H32BrNO6 — CID 995403
propan-2-yl (4S,7S)-4-(5-bromo-2-methoxyphenyl)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate (PubChem CID 995403) has the molecular formula C29H32BrNO6 and a molecular weight of 570.48 g/mol. Its IUPAC name is propan-2-yl (4S,7S)-4-(5-bromo-2-methoxyphenyl)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate.
| Compound Name | propan-2-yl (4S,7S)-4-(5-bromo-2-methoxyphenyl)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 995403 |
| Molecular Formula | C29H32BrNO6 |
| Molecular Weight | 570.48 g/mol |
| Exact Mass | 569.14 |
| IUPAC Name | propan-2-yl (4S,7S)-4-(5-bromo-2-methoxyphenyl)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
| SMILES | COc1ccc([C@@H]2CC(=O)C3=C(C2)NC(C)=C(C(=O)OC(C)C)[C@H]3c2cc(Br)ccc2OC)cc1OC |
| InChI | InChI=1S/C29H32BrNO6/c1-15(2)37-29(33)26-16(3)31-21-11-18(17-7-9-24(35-5)25(13-17)36-6)12-22(32)28(21)27(26)20-14-19(30)8-10-23(20)34-4/h7-10,13-15,18,27,31H,11-12H2,1-6H3/t18-,27+/m0/s1 |
| InChIKey | JGYWMZDKZHOOJK-XRHLQHRESA-N |
| XLogP | 5.79 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.48 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |