C27H28BrNO6 — CID 995663
methyl (4S,7R)-4-(5-bromo-2-methoxyphenyl)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate (PubChem CID 995663) has the molecular formula C27H28BrNO6 and a molecular weight of 542.43 g/mol. Its IUPAC name is methyl (4S,7R)-4-(5-bromo-2-methoxyphenyl)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate.
| Compound Name | methyl (4S,7R)-4-(5-bromo-2-methoxyphenyl)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 995663 |
| Molecular Formula | C27H28BrNO6 |
| Molecular Weight | 542.43 g/mol |
| Exact Mass | 541.11 |
| IUPAC Name | methyl (4S,7R)-4-(5-bromo-2-methoxyphenyl)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
| SMILES | COC(=O)C1=C(C)NC2=C(C(=O)C[C@H](c3ccc(OC)c(OC)c3)C2)[C@@H]1c1cc(Br)ccc1OC |
| InChI | InChI=1S/C27H28BrNO6/c1-14-24(27(31)35-5)25(18-13-17(28)7-9-21(18)32-2)26-19(29-14)10-16(11-20(26)30)15-6-8-22(33-3)23(12-15)34-4/h6-9,12-13,16,25,29H,10-11H2,1-5H3/t16-,25-/m1/s1 |
| InChIKey | PDDNTAHRDPMZNX-PUAOIOHZSA-N |
| XLogP | 5.01 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.43 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |