C27H31NO6 — CID 1130482
propan-2-yl (4R,7R)-7-(3,4-dimethoxyphenyl)-2-methyl-4-(5-methylfuran-2-yl)-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate (PubChem CID 1130482) has the molecular formula C27H31NO6 and a molecular weight of 465.55 g/mol. Its IUPAC name is propan-2-yl (4R,7R)-7-(3,4-dimethoxyphenyl)-2-methyl-4-(5-methylfuran-2-yl)-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate.
| Compound Name | propan-2-yl (4R,7R)-7-(3,4-dimethoxyphenyl)-2-methyl-4-(5-methylfuran-2-yl)-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 1130482 |
| Molecular Formula | C27H31NO6 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.22 |
| IUPAC Name | propan-2-yl (4R,7R)-7-(3,4-dimethoxyphenyl)-2-methyl-4-(5-methylfuran-2-yl)-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
| SMILES | COc1ccc([C@H]2CC(=O)C3=C(C2)NC(C)=C(C(=O)OC(C)C)[C@@H]3c2ccc(C)o2)cc1OC |
| InChI | InChI=1S/C27H31NO6/c1-14(2)33-27(30)24-16(4)28-19-11-18(17-8-10-21(31-5)23(13-17)32-6)12-20(29)25(19)26(24)22-9-7-15(3)34-22/h7-10,13-14,18,26,28H,11-12H2,1-6H3/t18-,26+/m1/s1 |
| InChIKey | UDVDKKBIUSEXAD-DWXRJYCRSA-N |
| XLogP | 4.92 |
| TPSA | 87.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |