C27H31NO7 — CID 51422373
2-methoxyethyl (4S,7S)-7-(3,4-dimethoxyphenyl)-2-methyl-4-(5-methylfuran-2-yl)-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate (PubChem CID 51422373) has the molecular formula C27H31NO7 and a molecular weight of 481.55 g/mol. Its IUPAC name is 2-methoxyethyl (4S,7S)-7-(3,4-dimethoxyphenyl)-2-methyl-4-(5-methylfuran-2-yl)-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate.
| Compound Name | 2-methoxyethyl (4S,7S)-7-(3,4-dimethoxyphenyl)-2-methyl-4-(5-methylfuran-2-yl)-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 51422373 |
| Molecular Formula | C27H31NO7 |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.21 |
| IUPAC Name | 2-methoxyethyl (4S,7S)-7-(3,4-dimethoxyphenyl)-2-methyl-4-(5-methylfuran-2-yl)-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
| SMILES | COCCOC(=O)C1=C(C)NC2=C(C(=O)C[C@@H](c3ccc(OC)c(OC)c3)C2)[C@@H]1c1ccc(C)o1 |
| InChI | InChI=1S/C27H31NO7/c1-15-6-8-22(35-15)26-24(27(30)34-11-10-31-3)16(2)28-19-12-18(13-20(29)25(19)26)17-7-9-21(32-4)23(14-17)33-5/h6-9,14,18,26,28H,10-13H2,1-5H3/t18-,26+/m0/s1 |
| InChIKey | ODRADZQJCFAUHA-HFJWLAOPSA-N |
| XLogP | 4.16 |
| TPSA | 96.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|