C24H23NO6 — CID 6485621
4-(1,3-benzodioxol-5-yl)-7-(3,4-dimethoxyphenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione (PubChem CID 6485621) has the molecular formula C24H23NO6 and a molecular weight of 421.45 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-yl)-7-(3,4-dimethoxyphenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione.
| Compound Name | 4-(1,3-benzodioxol-5-yl)-7-(3,4-dimethoxyphenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione |
|---|---|
| PubChem CID | 6485621 |
| Molecular Formula | C24H23NO6 |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | 4-(1,3-benzodioxol-5-yl)-7-(3,4-dimethoxyphenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione |
| SMILES | COc1ccc(C2CC(=O)C3=C(C2)NC(=O)CC3c2ccc3c(c2)OCO3)cc1OC |
| InChI | InChI=1S/C24H23NO6/c1-28-19-5-3-13(9-21(19)29-2)15-7-17-24(18(26)8-15)16(11-23(27)25-17)14-4-6-20-22(10-14)31-12-30-20/h3-6,9-10,15-16H,7-8,11-12H2,1-2H3,(H,25,27) |
| InChIKey | PTUSYTRQFXPLCY-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |