C20H17NO4S — CID 7248843
(4R,7S)-4-(1,3-benzodioxol-5-yl)-7-thiophen-2-yl-1,3,4,6,7,8-hexahydroquinoline-2,5-dione (PubChem CID 7248843) has the molecular formula C20H17NO4S and a molecular weight of 367.43 g/mol. Its IUPAC name is (4R,7S)-4-(1,3-benzodioxol-5-yl)-7-thiophen-2-yl-1,3,4,6,7,8-hexahydroquinoline-2,5-dione.
| Compound Name | (4R,7S)-4-(1,3-benzodioxol-5-yl)-7-thiophen-2-yl-1,3,4,6,7,8-hexahydroquinoline-2,5-dione |
|---|---|
| PubChem CID | 7248843 |
| Molecular Formula | C20H17NO4S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | (4R,7S)-4-(1,3-benzodioxol-5-yl)-7-thiophen-2-yl-1,3,4,6,7,8-hexahydroquinoline-2,5-dione |
| SMILES | O=C1C[C@H](c2ccc3c(c2)OCO3)C2=C(C[C@H](c3cccs3)CC2=O)N1 |
| InChI | InChI=1S/C20H17NO4S/c22-15-7-12(18-2-1-5-26-18)6-14-20(15)13(9-19(23)21-14)11-3-4-16-17(8-11)25-10-24-16/h1-5,8,12-13H,6-7,9-10H2,(H,21,23)/t12-,13+/m0/s1 |
| InChIKey | FRCMUJUWUASRDP-QWHCGFSZSA-N |
| XLogP | 3.48 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |