C19H15ClN2O4S — CID 7412989
(4S,7R)-4-(4-chloro-3-nitrophenyl)-7-thiophen-2-yl-1,3,4,6,7,8-hexahydroquinoline-2,5-dione (PubChem CID 7412989) has the molecular formula C19H15ClN2O4S and a molecular weight of 402.86 g/mol. Its IUPAC name is (4S,7R)-4-(4-chloro-3-nitrophenyl)-7-thiophen-2-yl-1,3,4,6,7,8-hexahydroquinoline-2,5-dione.
| Compound Name | (4S,7R)-4-(4-chloro-3-nitrophenyl)-7-thiophen-2-yl-1,3,4,6,7,8-hexahydroquinoline-2,5-dione |
|---|---|
| PubChem CID | 7412989 |
| Molecular Formula | C19H15ClN2O4S |
| Molecular Weight | 402.86 g/mol |
| Exact Mass | 402.04 |
| IUPAC Name | (4S,7R)-4-(4-chloro-3-nitrophenyl)-7-thiophen-2-yl-1,3,4,6,7,8-hexahydroquinoline-2,5-dione |
| SMILES | O=C1C[C@@H](c2ccc(Cl)c([N+](=O)[O-])c2)C2=C(C[C@@H](c3cccs3)CC2=O)N1 |
| InChI | InChI=1S/C19H15ClN2O4S/c20-13-4-3-10(7-15(13)22(25)26)12-9-18(24)21-14-6-11(8-16(23)19(12)14)17-2-1-5-27-17/h1-5,7,11-12H,6,8-9H2,(H,21,24)/t11-,12+/m1/s1 |
| InChIKey | MUDYKRAOWOUZJA-NEPJUHHUSA-N |
| XLogP | 4.31 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.86 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|