C24H23ClN2O5 — CID 17062722
4-(4-chloro-3-nitrophenyl)-7-(4-propoxyphenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione (PubChem CID 17062722) has the molecular formula C24H23ClN2O5 and a molecular weight of 454.91 g/mol. Its IUPAC name is 4-(4-chloro-3-nitrophenyl)-7-(4-propoxyphenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione.
| Compound Name | 4-(4-chloro-3-nitrophenyl)-7-(4-propoxyphenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione |
|---|---|
| PubChem CID | 17062722 |
| Molecular Formula | C24H23ClN2O5 |
| Molecular Weight | 454.91 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | 4-(4-chloro-3-nitrophenyl)-7-(4-propoxyphenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione |
| SMILES | CCCOc1ccc(C2CC(=O)C3=C(C2)NC(=O)CC3c2ccc(Cl)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C24H23ClN2O5/c1-2-9-32-17-6-3-14(4-7-17)16-10-20-24(22(28)12-16)18(13-23(29)26-20)15-5-8-19(25)21(11-15)27(30)31/h3-8,11,16,18H,2,9-10,12-13H2,1H3,(H,26,29) |
| InChIKey | GYFSAQSRZOYMHE-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.91 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|