C22H19Cl2NO3 — CID 40645206
(4S,7R)-4-(3,4-dichlorophenyl)-7-(4-methoxyphenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione (PubChem CID 40645206) has the molecular formula C22H19Cl2NO3 and a molecular weight of 416.30 g/mol. Its IUPAC name is (4S,7R)-4-(3,4-dichlorophenyl)-7-(4-methoxyphenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione.
| Compound Name | (4S,7R)-4-(3,4-dichlorophenyl)-7-(4-methoxyphenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione |
|---|---|
| PubChem CID | 40645206 |
| Molecular Formula | C22H19Cl2NO3 |
| Molecular Weight | 416.30 g/mol |
| Exact Mass | 415.07 |
| IUPAC Name | (4S,7R)-4-(3,4-dichlorophenyl)-7-(4-methoxyphenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione |
| SMILES | COc1ccc([C@H]2CC(=O)C3=C(C2)NC(=O)C[C@H]3c2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C22H19Cl2NO3/c1-28-15-5-2-12(3-6-15)14-9-19-22(20(26)10-14)16(11-21(27)25-19)13-4-7-17(23)18(24)8-13/h2-8,14,16H,9-11H2,1H3,(H,25,27)/t14-,16+/m1/s1 |
| InChIKey | LJFJBKHTYFFELB-ZBFHGGJFSA-N |
| XLogP | 5.01 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.30 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |