C22H20FNO3 — CID 17060683
4-(3-fluorophenyl)-7-(4-methoxyphenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione (PubChem CID 17060683) has the molecular formula C22H20FNO3 and a molecular weight of 365.40 g/mol. Its IUPAC name is 4-(3-fluorophenyl)-7-(4-methoxyphenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione.
| Compound Name | 4-(3-fluorophenyl)-7-(4-methoxyphenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione |
|---|---|
| PubChem CID | 17060683 |
| Molecular Formula | C22H20FNO3 |
| Molecular Weight | 365.40 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 4-(3-fluorophenyl)-7-(4-methoxyphenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione |
| SMILES | COc1ccc(C2CC(=O)C3=C(C2)NC(=O)CC3c2cccc(F)c2)cc1 |
| InChI | InChI=1S/C22H20FNO3/c1-27-17-7-5-13(6-8-17)15-10-19-22(20(25)11-15)18(12-21(26)24-19)14-3-2-4-16(23)9-14/h2-9,15,18H,10-12H2,1H3,(H,24,26) |
| InChIKey | YZIKUPLKYXFVGO-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.40 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |