C21H16Cl3NO2 — CID 17063815
4-(4-chlorophenyl)-7-(3,4-dichlorophenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione (PubChem CID 17063815) has the molecular formula C21H16Cl3NO2 and a molecular weight of 420.72 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-7-(3,4-dichlorophenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione.
| Compound Name | 4-(4-chlorophenyl)-7-(3,4-dichlorophenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione |
|---|---|
| PubChem CID | 17063815 |
| Molecular Formula | C21H16Cl3NO2 |
| Molecular Weight | 420.72 g/mol |
| Exact Mass | 419.02 |
| IUPAC Name | 4-(4-chlorophenyl)-7-(3,4-dichlorophenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione |
| SMILES | O=C1CC(c2ccc(Cl)cc2)C2=C(CC(c3ccc(Cl)c(Cl)c3)CC2=O)N1 |
| InChI | InChI=1S/C21H16Cl3NO2/c22-14-4-1-11(2-5-14)15-10-20(27)25-18-8-13(9-19(26)21(15)18)12-3-6-16(23)17(24)7-12/h1-7,13,15H,8-10H2,(H,25,27) |
| InChIKey | OWSWHEXYFNWGHL-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.72 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |