C21H18FNO2 — CID 40645073
(4R,7S)-7-(4-fluorophenyl)-4-phenyl-1,3,4,6,7,8-hexahydroquinoline-2,5-dione (PubChem CID 40645073) has the molecular formula C21H18FNO2 and a molecular weight of 335.38 g/mol. Its IUPAC name is (4R,7S)-7-(4-fluorophenyl)-4-phenyl-1,3,4,6,7,8-hexahydroquinoline-2,5-dione.
| Compound Name | (4R,7S)-7-(4-fluorophenyl)-4-phenyl-1,3,4,6,7,8-hexahydroquinoline-2,5-dione |
|---|---|
| PubChem CID | 40645073 |
| Molecular Formula | C21H18FNO2 |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | (4R,7S)-7-(4-fluorophenyl)-4-phenyl-1,3,4,6,7,8-hexahydroquinoline-2,5-dione |
| SMILES | O=C1C[C@H](c2ccccc2)C2=C(C[C@H](c3ccc(F)cc3)CC2=O)N1 |
| InChI | InChI=1S/C21H18FNO2/c22-16-8-6-13(7-9-16)15-10-18-21(19(24)11-15)17(12-20(25)23-18)14-4-2-1-3-5-14/h1-9,15,17H,10-12H2,(H,23,25)/t15-,17+/m0/s1 |
| InChIKey | BTNZQCZAXJRXJY-DOTOQJQBSA-N |
| XLogP | 3.83 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |