C21H17F2NO2 — CID 17061732
4-(2,5-difluorophenyl)-7-phenyl-1,3,4,6,7,8-hexahydroquinoline-2,5-dione (PubChem CID 17061732) has the molecular formula C21H17F2NO2 and a molecular weight of 353.37 g/mol. Its IUPAC name is 4-(2,5-difluorophenyl)-7-phenyl-1,3,4,6,7,8-hexahydroquinoline-2,5-dione.
| Compound Name | 4-(2,5-difluorophenyl)-7-phenyl-1,3,4,6,7,8-hexahydroquinoline-2,5-dione |
|---|---|
| PubChem CID | 17061732 |
| Molecular Formula | C21H17F2NO2 |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | 4-(2,5-difluorophenyl)-7-phenyl-1,3,4,6,7,8-hexahydroquinoline-2,5-dione |
| SMILES | O=C1CC(c2cc(F)ccc2F)C2=C(CC(c3ccccc3)CC2=O)N1 |
| InChI | InChI=1S/C21H17F2NO2/c22-14-6-7-17(23)15(10-14)16-11-20(26)24-18-8-13(9-19(25)21(16)18)12-4-2-1-3-5-12/h1-7,10,13,16H,8-9,11H2,(H,24,26) |
| InChIKey | YFQNKVSVYZYOHN-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |