C24H23F2NO3 — CID 17061251
4-(2,5-difluorophenyl)-7-(4-propan-2-yloxyphenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione (PubChem CID 17061251) has the molecular formula C24H23F2NO3 and a molecular weight of 411.45 g/mol. Its IUPAC name is 4-(2,5-difluorophenyl)-7-(4-propan-2-yloxyphenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione.
| Compound Name | 4-(2,5-difluorophenyl)-7-(4-propan-2-yloxyphenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione |
|---|---|
| PubChem CID | 17061251 |
| Molecular Formula | C24H23F2NO3 |
| Molecular Weight | 411.45 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | 4-(2,5-difluorophenyl)-7-(4-propan-2-yloxyphenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione |
| SMILES | CC(C)Oc1ccc(C2CC(=O)C3=C(C2)NC(=O)CC3c2cc(F)ccc2F)cc1 |
| InChI | InChI=1S/C24H23F2NO3/c1-13(2)30-17-6-3-14(4-7-17)15-9-21-24(22(28)10-15)19(12-23(29)27-21)18-11-16(25)5-8-20(18)26/h3-8,11,13,15,19H,9-10,12H2,1-2H3,(H,27,29) |
| InChIKey | PUVAGUYRNBSYNT-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.45 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |