C28H33NO4 — CID 17061191
7-[4-(2-methylpropoxy)phenyl]-4-(4-propan-2-yloxyphenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione (PubChem CID 17061191) has the molecular formula C28H33NO4 and a molecular weight of 447.58 g/mol. Its IUPAC name is 7-[4-(2-methylpropoxy)phenyl]-4-(4-propan-2-yloxyphenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione.
| Compound Name | 7-[4-(2-methylpropoxy)phenyl]-4-(4-propan-2-yloxyphenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione |
|---|---|
| PubChem CID | 17061191 |
| Molecular Formula | C28H33NO4 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.24 |
| IUPAC Name | 7-[4-(2-methylpropoxy)phenyl]-4-(4-propan-2-yloxyphenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione |
| SMILES | CC(C)COc1ccc(C2CC(=O)C3=C(C2)NC(=O)CC3c2ccc(OC(C)C)cc2)cc1 |
| InChI | InChI=1S/C28H33NO4/c1-17(2)16-32-22-9-5-19(6-10-22)21-13-25-28(26(30)14-21)24(15-27(31)29-25)20-7-11-23(12-8-20)33-18(3)4/h5-12,17-18,21,24H,13-16H2,1-4H3,(H,29,31) |
| InChIKey | TYZDCDMEUGLVJL-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |