C32H33NO5 — CID 17063688
4-(3-methoxy-4-phenylmethoxyphenyl)-7-(4-propan-2-yloxyphenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione (PubChem CID 17063688) has the molecular formula C32H33NO5 and a molecular weight of 511.62 g/mol. Its IUPAC name is 4-(3-methoxy-4-phenylmethoxyphenyl)-7-(4-propan-2-yloxyphenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione.
| Compound Name | 4-(3-methoxy-4-phenylmethoxyphenyl)-7-(4-propan-2-yloxyphenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione |
|---|---|
| PubChem CID | 17063688 |
| Molecular Formula | C32H33NO5 |
| Molecular Weight | 511.62 g/mol |
| Exact Mass | 511.24 |
| IUPAC Name | 4-(3-methoxy-4-phenylmethoxyphenyl)-7-(4-propan-2-yloxyphenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione |
| SMILES | COc1cc(C2CC(=O)NC3=C2C(=O)CC(c2ccc(OC(C)C)cc2)C3)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C32H33NO5/c1-20(2)38-25-12-9-22(10-13-25)24-15-27-32(28(34)16-24)26(18-31(35)33-27)23-11-14-29(30(17-23)36-3)37-19-21-7-5-4-6-8-21/h4-14,17,20,24,26H,15-16,18-19H2,1-3H3,(H,33,35) |
| InChIKey | XHDKUZRGTWKHQN-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.62 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |