C31H31NO4 — CID 17062059
7-(4-ethylphenyl)-4-(3-methoxy-4-phenylmethoxyphenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione (PubChem CID 17062059) has the molecular formula C31H31NO4 and a molecular weight of 481.59 g/mol. Its IUPAC name is 7-(4-ethylphenyl)-4-(3-methoxy-4-phenylmethoxyphenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione.
| Compound Name | 7-(4-ethylphenyl)-4-(3-methoxy-4-phenylmethoxyphenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione |
|---|---|
| PubChem CID | 17062059 |
| Molecular Formula | C31H31NO4 |
| Molecular Weight | 481.59 g/mol |
| Exact Mass | 481.23 |
| IUPAC Name | 7-(4-ethylphenyl)-4-(3-methoxy-4-phenylmethoxyphenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione |
| SMILES | CCc1ccc(C2CC(=O)C3=C(C2)NC(=O)CC3c2ccc(OCc3ccccc3)c(OC)c2)cc1 |
| InChI | InChI=1S/C31H31NO4/c1-3-20-9-11-22(12-10-20)24-15-26-31(27(33)16-24)25(18-30(34)32-26)23-13-14-28(29(17-23)35-2)36-19-21-7-5-4-6-8-21/h4-14,17,24-25H,3,15-16,18-19H2,1-2H3,(H,32,34) |
| InChIKey | IPNIFJLUCQKDHB-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.59 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |