C25H26BrNO4 — CID 17062377
4-(3-bromo-4,5-dimethoxyphenyl)-7-(4-ethylphenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione (PubChem CID 17062377) has the molecular formula C25H26BrNO4 and a molecular weight of 484.39 g/mol. Its IUPAC name is 4-(3-bromo-4,5-dimethoxyphenyl)-7-(4-ethylphenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione.
| Compound Name | 4-(3-bromo-4,5-dimethoxyphenyl)-7-(4-ethylphenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione |
|---|---|
| PubChem CID | 17062377 |
| Molecular Formula | C25H26BrNO4 |
| Molecular Weight | 484.39 g/mol |
| Exact Mass | 483.10 |
| IUPAC Name | 4-(3-bromo-4,5-dimethoxyphenyl)-7-(4-ethylphenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione |
| SMILES | CCc1ccc(C2CC(=O)C3=C(C2)NC(=O)CC3c2cc(Br)c(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C25H26BrNO4/c1-4-14-5-7-15(8-6-14)16-10-20-24(21(28)11-16)18(13-23(29)27-20)17-9-19(26)25(31-3)22(12-17)30-2/h5-9,12,16,18H,4,10-11,13H2,1-3H3,(H,27,29) |
| InChIKey | WHYCDEHBTKFWPY-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.39 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |