C28H32BrNO7 — CID 17062821
4-(3-bromo-4,5-diethoxyphenyl)-7-(3,4,5-trimethoxyphenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione (PubChem CID 17062821) has the molecular formula C28H32BrNO7 and a molecular weight of 574.47 g/mol. Its IUPAC name is 4-(3-bromo-4,5-diethoxyphenyl)-7-(3,4,5-trimethoxyphenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione.
| Compound Name | 4-(3-bromo-4,5-diethoxyphenyl)-7-(3,4,5-trimethoxyphenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione |
|---|---|
| PubChem CID | 17062821 |
| Molecular Formula | C28H32BrNO7 |
| Molecular Weight | 574.47 g/mol |
| Exact Mass | 573.14 |
| IUPAC Name | 4-(3-bromo-4,5-diethoxyphenyl)-7-(3,4,5-trimethoxyphenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione |
| SMILES | CCOc1cc(C2CC(=O)NC3=C2C(=O)CC(c2cc(OC)c(OC)c(OC)c2)C3)cc(Br)c1OCC |
| InChI | InChI=1S/C28H32BrNO7/c1-6-36-24-13-17(8-19(29)27(24)37-7-2)18-14-25(32)30-20-9-15(10-21(31)26(18)20)16-11-22(33-3)28(35-5)23(12-16)34-4/h8,11-13,15,18H,6-7,9-10,14H2,1-5H3,(H,30,32) |
| InChIKey | AYMPEVGBNDMUAZ-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.47 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |