C28H27NO5 — CID 17064826
4-naphthalen-1-yl-7-(3,4,5-trimethoxyphenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione (PubChem CID 17064826) has the molecular formula C28H27NO5 and a molecular weight of 457.53 g/mol. Its IUPAC name is 4-naphthalen-1-yl-7-(3,4,5-trimethoxyphenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione.
| Compound Name | 4-naphthalen-1-yl-7-(3,4,5-trimethoxyphenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione |
|---|---|
| PubChem CID | 17064826 |
| Molecular Formula | C28H27NO5 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.19 |
| IUPAC Name | 4-naphthalen-1-yl-7-(3,4,5-trimethoxyphenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione |
| SMILES | COc1cc(C2CC(=O)C3=C(C2)NC(=O)CC3c2cccc3ccccc23)cc(OC)c1OC |
| InChI | InChI=1S/C28H27NO5/c1-32-24-13-18(14-25(33-2)28(24)34-3)17-11-22-27(23(30)12-17)21(15-26(31)29-22)20-10-6-8-16-7-4-5-9-19(16)20/h4-10,13-14,17,21H,11-12,15H2,1-3H3,(H,29,31) |
| InChIKey | ILTJZFVUFZIFCU-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |