C25H27NO5 — CID 17060644
7-(3,4-dimethoxyphenyl)-4-(2-ethoxyphenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione (PubChem CID 17060644) has the molecular formula C25H27NO5 and a molecular weight of 421.49 g/mol. Its IUPAC name is 7-(3,4-dimethoxyphenyl)-4-(2-ethoxyphenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione.
| Compound Name | 7-(3,4-dimethoxyphenyl)-4-(2-ethoxyphenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione |
|---|---|
| PubChem CID | 17060644 |
| Molecular Formula | C25H27NO5 |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | 7-(3,4-dimethoxyphenyl)-4-(2-ethoxyphenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione |
| SMILES | CCOc1ccccc1C1CC(=O)NC2=C1C(=O)CC(c1ccc(OC)c(OC)c1)C2 |
| InChI | InChI=1S/C25H27NO5/c1-4-31-21-8-6-5-7-17(21)18-14-24(28)26-19-11-16(12-20(27)25(18)19)15-9-10-22(29-2)23(13-15)30-3/h5-10,13,16,18H,4,11-12,14H2,1-3H3,(H,26,28) |
| InChIKey | ZOXKBZXTHZDKGZ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |