C24H25NO5 — CID 17061170
7-(4-ethoxy-3-methoxyphenyl)-4-(3-hydroxyphenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione (PubChem CID 17061170) has the molecular formula C24H25NO5 and a molecular weight of 407.47 g/mol. Its IUPAC name is 7-(4-ethoxy-3-methoxyphenyl)-4-(3-hydroxyphenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione.
| Compound Name | 7-(4-ethoxy-3-methoxyphenyl)-4-(3-hydroxyphenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione |
|---|---|
| PubChem CID | 17061170 |
| Molecular Formula | C24H25NO5 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | 7-(4-ethoxy-3-methoxyphenyl)-4-(3-hydroxyphenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione |
| SMILES | CCOc1ccc(C2CC(=O)C3=C(C2)NC(=O)CC3c2cccc(O)c2)cc1OC |
| InChI | InChI=1S/C24H25NO5/c1-3-30-21-8-7-14(12-22(21)29-2)16-10-19-24(20(27)11-16)18(13-23(28)25-19)15-5-4-6-17(26)9-15/h4-9,12,16,18,26H,3,10-11,13H2,1-2H3,(H,25,28) |
| InChIKey | QJTWGLQGVLVIOV-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |