C29H27NO4 — CID 17061843
4-(3-methoxy-4-phenylmethoxyphenyl)-7-phenyl-1,3,4,6,7,8-hexahydroquinoline-2,5-dione (PubChem CID 17061843) has the molecular formula C29H27NO4 and a molecular weight of 453.54 g/mol. Its IUPAC name is 4-(3-methoxy-4-phenylmethoxyphenyl)-7-phenyl-1,3,4,6,7,8-hexahydroquinoline-2,5-dione.
| Compound Name | 4-(3-methoxy-4-phenylmethoxyphenyl)-7-phenyl-1,3,4,6,7,8-hexahydroquinoline-2,5-dione |
|---|---|
| PubChem CID | 17061843 |
| Molecular Formula | C29H27NO4 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | 4-(3-methoxy-4-phenylmethoxyphenyl)-7-phenyl-1,3,4,6,7,8-hexahydroquinoline-2,5-dione |
| SMILES | COc1cc(C2CC(=O)NC3=C2C(=O)CC(c2ccccc2)C3)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C29H27NO4/c1-33-27-16-21(12-13-26(27)34-18-19-8-4-2-5-9-19)23-17-28(32)30-24-14-22(15-25(31)29(23)24)20-10-6-3-7-11-20/h2-13,16,22-23H,14-15,17-18H2,1H3,(H,30,32) |
| InChIKey | ALWOAGVFWBZEHG-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |