C30H29NO5 — CID 17062698
7-(3-methoxyphenyl)-4-(3-methoxy-4-phenylmethoxyphenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione (PubChem CID 17062698) has the molecular formula C30H29NO5 and a molecular weight of 483.56 g/mol. Its IUPAC name is 7-(3-methoxyphenyl)-4-(3-methoxy-4-phenylmethoxyphenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione.
| Compound Name | 7-(3-methoxyphenyl)-4-(3-methoxy-4-phenylmethoxyphenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione |
|---|---|
| PubChem CID | 17062698 |
| Molecular Formula | C30H29NO5 |
| Molecular Weight | 483.56 g/mol |
| Exact Mass | 483.20 |
| IUPAC Name | 7-(3-methoxyphenyl)-4-(3-methoxy-4-phenylmethoxyphenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione |
| SMILES | COc1cccc(C2CC(=O)C3=C(C2)NC(=O)CC3c2ccc(OCc3ccccc3)c(OC)c2)c1 |
| InChI | InChI=1S/C30H29NO5/c1-34-23-10-6-9-20(13-23)22-14-25-30(26(32)15-22)24(17-29(33)31-25)21-11-12-27(28(16-21)35-2)36-18-19-7-4-3-5-8-19/h3-13,16,22,24H,14-15,17-18H2,1-2H3,(H,31,33) |
| InChIKey | PJRGFQGLCNYCPZ-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.56 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |