C34H32N2O4 — CID 17064415
9-(3-methoxyphenyl)-6-(3-methoxy-4-phenylmethoxyphenyl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one (PubChem CID 17064415) has the molecular formula C34H32N2O4 and a molecular weight of 532.64 g/mol. Its IUPAC name is 9-(3-methoxyphenyl)-6-(3-methoxy-4-phenylmethoxyphenyl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one.
| Compound Name | 9-(3-methoxyphenyl)-6-(3-methoxy-4-phenylmethoxyphenyl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 17064415 |
| Molecular Formula | C34H32N2O4 |
| Molecular Weight | 532.64 g/mol |
| Exact Mass | 532.24 |
| IUPAC Name | 9-(3-methoxyphenyl)-6-(3-methoxy-4-phenylmethoxyphenyl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
| SMILES | COc1cccc(C2CC(=O)C3=C(C2)Nc2ccccc2NC3c2ccc(OCc3ccccc3)c(OC)c2)c1 |
| InChI | InChI=1S/C34H32N2O4/c1-38-26-12-8-11-23(17-26)25-18-29-33(30(37)19-25)34(36-28-14-7-6-13-27(28)35-29)24-15-16-31(32(20-24)39-2)40-21-22-9-4-3-5-10-22/h3-17,20,25,34-36H,18-19,21H2,1-2H3 |
| InChIKey | FHRWMYBNXXSKAM-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.64 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |