C26H29NO5 — CID 17062341
4-(3-methoxyphenyl)-7-(3-methoxy-4-propan-2-yloxyphenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione (PubChem CID 17062341) has the molecular formula C26H29NO5 and a molecular weight of 435.52 g/mol. Its IUPAC name is 4-(3-methoxyphenyl)-7-(3-methoxy-4-propan-2-yloxyphenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione.
| Compound Name | 4-(3-methoxyphenyl)-7-(3-methoxy-4-propan-2-yloxyphenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione |
|---|---|
| PubChem CID | 17062341 |
| Molecular Formula | C26H29NO5 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | 4-(3-methoxyphenyl)-7-(3-methoxy-4-propan-2-yloxyphenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione |
| SMILES | COc1cccc(C2CC(=O)NC3=C2C(=O)CC(c2ccc(OC(C)C)c(OC)c2)C3)c1 |
| InChI | InChI=1S/C26H29NO5/c1-15(2)32-23-9-8-16(13-24(23)31-4)18-11-21-26(22(28)12-18)20(14-25(29)27-21)17-6-5-7-19(10-17)30-3/h5-10,13,15,18,20H,11-12,14H2,1-4H3,(H,27,29) |
| InChIKey | HMEQPQIDDTWEOW-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |