C28H33NO7 — CID 17061535
4-(3-methoxy-2-propoxyphenyl)-7-(3,4,5-trimethoxyphenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione (PubChem CID 17061535) has the molecular formula C28H33NO7 and a molecular weight of 495.57 g/mol. Its IUPAC name is 4-(3-methoxy-2-propoxyphenyl)-7-(3,4,5-trimethoxyphenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione.
| Compound Name | 4-(3-methoxy-2-propoxyphenyl)-7-(3,4,5-trimethoxyphenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione |
|---|---|
| PubChem CID | 17061535 |
| Molecular Formula | C28H33NO7 |
| Molecular Weight | 495.57 g/mol |
| Exact Mass | 495.23 |
| IUPAC Name | 4-(3-methoxy-2-propoxyphenyl)-7-(3,4,5-trimethoxyphenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione |
| SMILES | CCCOc1c(OC)cccc1C1CC(=O)NC2=C1C(=O)CC(c1cc(OC)c(OC)c(OC)c1)C2 |
| InChI | InChI=1S/C28H33NO7/c1-6-10-36-27-18(8-7-9-22(27)32-2)19-15-25(31)29-20-11-16(12-21(30)26(19)20)17-13-23(33-3)28(35-5)24(14-17)34-4/h7-9,13-14,16,19H,6,10-12,15H2,1-5H3,(H,29,31) |
| InChIKey | LHQAMWOFHDBGBI-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.57 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |