C25H20F2N2O — CID 1039596
(6R,9S)-6-(2,5-difluorophenyl)-9-phenyl-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one (PubChem CID 1039596) has the molecular formula C25H20F2N2O and a molecular weight of 402.44 g/mol. Its IUPAC name is (6R,9S)-6-(2,5-difluorophenyl)-9-phenyl-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one.
| Compound Name | (6R,9S)-6-(2,5-difluorophenyl)-9-phenyl-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 1039596 |
| Molecular Formula | C25H20F2N2O |
| Molecular Weight | 402.44 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | (6R,9S)-6-(2,5-difluorophenyl)-9-phenyl-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
| SMILES | O=C1C[C@@H](c2ccccc2)CC2=C1[C@H](c1cc(F)ccc1F)Nc1ccccc1N2 |
| InChI | InChI=1S/C25H20F2N2O/c26-17-10-11-19(27)18(14-17)25-24-22(28-20-8-4-5-9-21(20)29-25)12-16(13-23(24)30)15-6-2-1-3-7-15/h1-11,14,16,25,28-29H,12-13H2/t16-,25-/m0/s1 |
| InChIKey | XXZYQBNZJPDXAW-LMKMVOKYSA-N |
| XLogP | 5.94 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.44 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |