C25H19Cl3N2O — CID 7088899
(6S,9S)-9-(4-chlorophenyl)-6-(2,4-dichlorophenyl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one (PubChem CID 7088899) has the molecular formula C25H19Cl3N2O and a molecular weight of 469.80 g/mol. Its IUPAC name is (6S,9S)-9-(4-chlorophenyl)-6-(2,4-dichlorophenyl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one.
| Compound Name | (6S,9S)-9-(4-chlorophenyl)-6-(2,4-dichlorophenyl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 7088899 |
| Molecular Formula | C25H19Cl3N2O |
| Molecular Weight | 469.80 g/mol |
| Exact Mass | 468.06 |
| IUPAC Name | (6S,9S)-9-(4-chlorophenyl)-6-(2,4-dichlorophenyl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
| SMILES | O=C1C[C@@H](c2ccc(Cl)cc2)CC2=C1[C@@H](c1ccc(Cl)cc1Cl)Nc1ccccc1N2 |
| InChI | InChI=1S/C25H19Cl3N2O/c26-16-7-5-14(6-8-16)15-11-22-24(23(31)12-15)25(18-10-9-17(27)13-19(18)28)30-21-4-2-1-3-20(21)29-22/h1-10,13,15,25,29-30H,11-12H2/t15-,25+/m0/s1 |
| InChIKey | RVROFCQPMGRUNH-ODCWNRFASA-N |
| XLogP | 7.63 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.80 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |