C27H25Cl2N3O — CID 17064670
6-(2,4-dichlorophenyl)-9-[4-(dimethylamino)phenyl]-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one (PubChem CID 17064670) has the molecular formula C27H25Cl2N3O and a molecular weight of 478.42 g/mol. Its IUPAC name is 6-(2,4-dichlorophenyl)-9-[4-(dimethylamino)phenyl]-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one.
| Compound Name | 6-(2,4-dichlorophenyl)-9-[4-(dimethylamino)phenyl]-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 17064670 |
| Molecular Formula | C27H25Cl2N3O |
| Molecular Weight | 478.42 g/mol |
| Exact Mass | 477.14 |
| IUPAC Name | 6-(2,4-dichlorophenyl)-9-[4-(dimethylamino)phenyl]-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
| SMILES | CN(C)c1ccc(C2CC(=O)C3=C(C2)Nc2ccccc2NC3c2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C27H25Cl2N3O/c1-32(2)19-10-7-16(8-11-19)17-13-24-26(25(33)14-17)27(20-12-9-18(28)15-21(20)29)31-23-6-4-3-5-22(23)30-24/h3-12,15,17,27,30-31H,13-14H2,1-2H3 |
| InChIKey | FDNOUEUJIVGZLY-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.42 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|