C29H31N3O2 — CID 17065140
9-[4-(dimethylamino)phenyl]-6-(2-ethoxyphenyl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one (PubChem CID 17065140) has the molecular formula C29H31N3O2 and a molecular weight of 453.59 g/mol. Its IUPAC name is 9-[4-(dimethylamino)phenyl]-6-(2-ethoxyphenyl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one.
| Compound Name | 9-[4-(dimethylamino)phenyl]-6-(2-ethoxyphenyl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 17065140 |
| Molecular Formula | C29H31N3O2 |
| Molecular Weight | 453.59 g/mol |
| Exact Mass | 453.24 |
| IUPAC Name | 9-[4-(dimethylamino)phenyl]-6-(2-ethoxyphenyl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
| SMILES | CCOc1ccccc1C1Nc2ccccc2NC2=C1C(=O)CC(c1ccc(N(C)C)cc1)C2 |
| InChI | InChI=1S/C29H31N3O2/c1-4-34-27-12-8-5-9-22(27)29-28-25(30-23-10-6-7-11-24(23)31-29)17-20(18-26(28)33)19-13-15-21(16-14-19)32(2)3/h5-16,20,29-31H,4,17-18H2,1-3H3 |
| InChIKey | UXCANVJYPGNGHH-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.59 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|