C27H26N4O3 — CID 17064140
9-[4-(dimethylamino)phenyl]-6-(2-nitrophenyl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one (PubChem CID 17064140) has the molecular formula C27H26N4O3 and a molecular weight of 454.53 g/mol. Its IUPAC name is 9-[4-(dimethylamino)phenyl]-6-(2-nitrophenyl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one.
| Compound Name | 9-[4-(dimethylamino)phenyl]-6-(2-nitrophenyl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 17064140 |
| Molecular Formula | C27H26N4O3 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | 9-[4-(dimethylamino)phenyl]-6-(2-nitrophenyl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
| SMILES | CN(C)c1ccc(C2CC(=O)C3=C(C2)Nc2ccccc2NC3c2ccccc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C27H26N4O3/c1-30(2)19-13-11-17(12-14-19)18-15-23-26(25(32)16-18)27(20-7-3-6-10-24(20)31(33)34)29-22-9-5-4-8-21(22)28-23/h3-14,18,27-29H,15-16H2,1-2H3 |
| InChIKey | CIZAGJQLHDZDHM-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 87.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|