C25H20FN3O3 — CID 17064635
9-(4-fluorophenyl)-6-(2-nitrophenyl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one (PubChem CID 17064635) has the molecular formula C25H20FN3O3 and a molecular weight of 429.45 g/mol. Its IUPAC name is 9-(4-fluorophenyl)-6-(2-nitrophenyl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one.
| Compound Name | 9-(4-fluorophenyl)-6-(2-nitrophenyl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 17064635 |
| Molecular Formula | C25H20FN3O3 |
| Molecular Weight | 429.45 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | 9-(4-fluorophenyl)-6-(2-nitrophenyl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
| SMILES | O=C1CC(c2ccc(F)cc2)CC2=C1C(c1ccccc1[N+](=O)[O-])Nc1ccccc1N2 |
| InChI | InChI=1S/C25H20FN3O3/c26-17-11-9-15(10-12-17)16-13-21-24(23(30)14-16)25(18-5-1-4-8-22(18)29(31)32)28-20-7-3-2-6-19(20)27-21/h1-12,16,25,27-28H,13-14H2 |
| InChIKey | FQQJTOGKYRPJBR-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.45 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|