C25H20ClN3O3 — CID 2884999
6-(2-chloro-5-nitrophenyl)-9-phenyl-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one (PubChem CID 2884999) has the molecular formula C25H20ClN3O3 and a molecular weight of 445.91 g/mol. Its IUPAC name is 6-(2-chloro-5-nitrophenyl)-9-phenyl-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one.
| Compound Name | 6-(2-chloro-5-nitrophenyl)-9-phenyl-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 2884999 |
| Molecular Formula | C25H20ClN3O3 |
| Molecular Weight | 445.91 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | 6-(2-chloro-5-nitrophenyl)-9-phenyl-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
| SMILES | O=C1CC(c2ccccc2)CC2=C1C(c1cc([N+](=O)[O-])ccc1Cl)Nc1ccccc1N2 |
| InChI | InChI=1S/C25H20ClN3O3/c26-19-11-10-17(29(31)32)14-18(19)25-24-22(27-20-8-4-5-9-21(20)28-25)12-16(13-23(24)30)15-6-2-1-3-7-15/h1-11,14,16,25,27-28H,12-13H2 |
| InChIKey | KFDGLDPNDVLWLR-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.91 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|