C29H24N2O — CID 7093234
(6S,9S)-6-naphthalen-1-yl-9-phenyl-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one (PubChem CID 7093234) has the molecular formula C29H24N2O and a molecular weight of 416.52 g/mol. Its IUPAC name is (6S,9S)-6-naphthalen-1-yl-9-phenyl-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one.
| Compound Name | (6S,9S)-6-naphthalen-1-yl-9-phenyl-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 7093234 |
| Molecular Formula | C29H24N2O |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | (6S,9S)-6-naphthalen-1-yl-9-phenyl-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
| SMILES | O=C1C[C@@H](c2ccccc2)CC2=C1[C@H](c1cccc3ccccc13)Nc1ccccc1N2 |
| InChI | InChI=1S/C29H24N2O/c32-27-18-21(19-9-2-1-3-10-19)17-26-28(27)29(31-25-16-7-6-15-24(25)30-26)23-14-8-12-20-11-4-5-13-22(20)23/h1-16,21,29-31H,17-18H2/t21-,29-/m0/s1 |
| InChIKey | ZXWCIBNYFFQUJF-LGGPFLRQSA-N |
| XLogP | 6.82 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |