C29H29FN2O — CID 41043019
(6R,9S)-9-(4-tert-butylphenyl)-6-(4-fluorophenyl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one (PubChem CID 41043019) has the molecular formula C29H29FN2O and a molecular weight of 440.56 g/mol. Its IUPAC name is (6R,9S)-9-(4-tert-butylphenyl)-6-(4-fluorophenyl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one.
| Compound Name | (6R,9S)-9-(4-tert-butylphenyl)-6-(4-fluorophenyl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 41043019 |
| Molecular Formula | C29H29FN2O |
| Molecular Weight | 440.56 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | (6R,9S)-9-(4-tert-butylphenyl)-6-(4-fluorophenyl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
| SMILES | CC(C)(C)c1ccc([C@@H]2CC(=O)C3=C(C2)Nc2ccccc2N[C@@H]3c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C29H29FN2O/c1-29(2,3)21-12-8-18(9-13-21)20-16-25-27(26(33)17-20)28(19-10-14-22(30)15-11-19)32-24-7-5-4-6-23(24)31-25/h4-15,20,28,31-32H,16-17H2,1-3H3/t20-,28+/m0/s1 |
| InChIKey | YKUIWDOCWKLGNG-WTYVLRPYSA-N |
| XLogP | 7.10 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.56 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |