C28H25F3N2O — CID 17064229
9-(4-ethylphenyl)-6-[4-(trifluoromethyl)phenyl]-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one (PubChem CID 17064229) has the molecular formula C28H25F3N2O and a molecular weight of 462.52 g/mol. Its IUPAC name is 9-(4-ethylphenyl)-6-[4-(trifluoromethyl)phenyl]-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one.
| Compound Name | 9-(4-ethylphenyl)-6-[4-(trifluoromethyl)phenyl]-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 17064229 |
| Molecular Formula | C28H25F3N2O |
| Molecular Weight | 462.52 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | 9-(4-ethylphenyl)-6-[4-(trifluoromethyl)phenyl]-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
| SMILES | CCc1ccc(C2CC(=O)C3=C(C2)Nc2ccccc2NC3c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C28H25F3N2O/c1-2-17-7-9-18(10-8-17)20-15-24-26(25(34)16-20)27(33-23-6-4-3-5-22(23)32-24)19-11-13-21(14-12-19)28(29,30)31/h3-14,20,27,32-33H,2,15-16H2,1H3 |
| InChIKey | CPRHZWAOHTZCIV-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.52 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |