C31H32N2O3 — CID 40909675
methyl 4-[(6R,9S)-9-(4-tert-butylphenyl)-7-oxo-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-6-yl]benzoate (PubChem CID 40909675) has the molecular formula C31H32N2O3 and a molecular weight of 480.61 g/mol. Its IUPAC name is methyl 4-[(6R,9S)-9-(4-tert-butylphenyl)-7-oxo-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-6-yl]benzoate.
| Compound Name | methyl 4-[(6R,9S)-9-(4-tert-butylphenyl)-7-oxo-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-6-yl]benzoate |
|---|---|
| PubChem CID | 40909675 |
| Molecular Formula | C31H32N2O3 |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.24 |
| IUPAC Name | methyl 4-[(6R,9S)-9-(4-tert-butylphenyl)-7-oxo-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-6-yl]benzoate |
| SMILES | COC(=O)c1ccc([C@H]2Nc3ccccc3NC3=C2C(=O)C[C@@H](c2ccc(C(C)(C)C)cc2)C3)cc1 |
| InChI | InChI=1S/C31H32N2O3/c1-31(2,3)23-15-13-19(14-16-23)22-17-26-28(27(34)18-22)29(33-25-8-6-5-7-24(25)32-26)20-9-11-21(12-10-20)30(35)36-4/h5-16,22,29,32-33H,17-18H2,1-4H3/t22-,29+/m0/s1 |
| InChIKey | VLILULKVPHHGKL-PZGXJGMVSA-N |
| XLogP | 6.75 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |