C30H29F3N2O2 — CID 17065083
9-[4-(2-methylpropoxy)phenyl]-6-[4-(trifluoromethyl)phenyl]-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one (PubChem CID 17065083) has the molecular formula C30H29F3N2O2 and a molecular weight of 506.57 g/mol. Its IUPAC name is 9-[4-(2-methylpropoxy)phenyl]-6-[4-(trifluoromethyl)phenyl]-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one.
| Compound Name | 9-[4-(2-methylpropoxy)phenyl]-6-[4-(trifluoromethyl)phenyl]-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 17065083 |
| Molecular Formula | C30H29F3N2O2 |
| Molecular Weight | 506.57 g/mol |
| Exact Mass | 506.22 |
| IUPAC Name | 9-[4-(2-methylpropoxy)phenyl]-6-[4-(trifluoromethyl)phenyl]-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
| SMILES | CC(C)COc1ccc(C2CC(=O)C3=C(C2)Nc2ccccc2NC3c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C30H29F3N2O2/c1-18(2)17-37-23-13-9-19(10-14-23)21-15-26-28(27(36)16-21)29(35-25-6-4-3-5-24(25)34-26)20-7-11-22(12-8-20)30(31,32)33/h3-14,18,21,29,34-35H,15-17H2,1-2H3 |
| InChIKey | IEDQRYIEKUGTKC-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.57 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |