C31H35N3O2 — CID 17063525
6-[4-(dimethylamino)phenyl]-9-[4-(2-methylpropoxy)phenyl]-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one (PubChem CID 17063525) has the molecular formula C31H35N3O2 and a molecular weight of 481.64 g/mol. Its IUPAC name is 6-[4-(dimethylamino)phenyl]-9-[4-(2-methylpropoxy)phenyl]-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one.
| Compound Name | 6-[4-(dimethylamino)phenyl]-9-[4-(2-methylpropoxy)phenyl]-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 17063525 |
| Molecular Formula | C31H35N3O2 |
| Molecular Weight | 481.64 g/mol |
| Exact Mass | 481.27 |
| IUPAC Name | 6-[4-(dimethylamino)phenyl]-9-[4-(2-methylpropoxy)phenyl]-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
| SMILES | CC(C)COc1ccc(C2CC(=O)C3=C(C2)Nc2ccccc2NC3c2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C31H35N3O2/c1-20(2)19-36-25-15-11-21(12-16-25)23-17-28-30(29(35)18-23)31(22-9-13-24(14-10-22)34(3)4)33-27-8-6-5-7-26(27)32-28/h5-16,20,23,31-33H,17-19H2,1-4H3 |
| InChIKey | HALQRRFOHQTOPP-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.64 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |